Carboxylic acids and derivatives
Filtered Search Results
Methyl 3,3-dimethylacrylate, 98%
CAS: 924-50-5 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00043940 InChI Key: FZIBCCGGICGWBP-UHFFFAOYSA-N Synonym: methyl 3-methyl-2-butenoate,methyl 3,3-dimethylacrylate,2-butenoic acid, 3-methyl-, methyl ester,3-methyl-but-2-enoic acid methyl ester,methyl senecioate,3,3-dimethylacrylic acid methyl ester,methyl-3,3-dimethylacrylate,crotonic acid, 3-methyl-, methyl ester,methyl-3,3-dimethyl acrylate,methylsenecioate PubChem CID: 13546 IUPAC Name: methyl 3-methylbut-2-enoate SMILES: CC(=CC(=O)OC)C
| PubChem CID | 13546 |
|---|---|
| CAS | 924-50-5 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00043940 |
| SMILES | CC(=CC(=O)OC)C |
| Synonym | methyl 3-methyl-2-butenoate,methyl 3,3-dimethylacrylate,2-butenoic acid, 3-methyl-, methyl ester,3-methyl-but-2-enoic acid methyl ester,methyl senecioate,3,3-dimethylacrylic acid methyl ester,methyl-3,3-dimethylacrylate,crotonic acid, 3-methyl-, methyl ester,methyl-3,3-dimethyl acrylate,methylsenecioate |
| IUPAC Name | methyl 3-methylbut-2-enoate |
| InChI Key | FZIBCCGGICGWBP-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00007891 InChI Key: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonym: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester PubChem CID: 12082 IUPAC Name: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| PubChem CID | 12082 |
|---|---|
| CAS | 619-45-4 |
| Molecular Weight (g/mol) | 151.165 |
| MDL Number | MFCD00007891 |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Synonym | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| IUPAC Name | methyl 4-aminobenzoate |
| InChI Key | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Methyl biphenyl-4-carboxylate, 98+%
CAS: 720-75-2 Molecular Formula: C14H12O2 Molecular Weight (g/mol): 212.25 MDL Number: MFCD00017200 InChI Key: GATUGNVDXMYTJX-UHFFFAOYSA-N Synonym: methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester PubChem CID: 69757 IUPAC Name: methyl 4-phenylbenzoate SMILES: COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1
| PubChem CID | 69757 |
|---|---|
| CAS | 720-75-2 |
| Molecular Weight (g/mol) | 212.25 |
| MDL Number | MFCD00017200 |
| SMILES | COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1 |
| Synonym | methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester |
| IUPAC Name | methyl 4-phenylbenzoate |
| InChI Key | GATUGNVDXMYTJX-UHFFFAOYSA-N |
| Molecular Formula | C14H12O2 |
Antimony(III) acetate, 97%
CAS: 6923-52-0 Molecular Formula: C6H9O6Sb Molecular Weight (g/mol): 298.892 MDL Number: MFCD00014974 InChI Key: JVLRYPRBKSMEBF-UHFFFAOYSA-K Synonym: antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity PubChem CID: 23354 IUPAC Name: antimony(3+);triacetate SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3]
| PubChem CID | 23354 |
|---|---|
| CAS | 6923-52-0 |
| Molecular Weight (g/mol) | 298.892 |
| MDL Number | MFCD00014974 |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3] |
| Synonym | antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity |
| IUPAC Name | antimony(3+);triacetate |
| InChI Key | JVLRYPRBKSMEBF-UHFFFAOYSA-K |
| Molecular Formula | C6H9O6Sb |
2-Naphthylacetic acid, 99%
CAS: 581-96-4 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004126 InChI Key: VIBOGIYPPWLDTI-UHFFFAOYSA-N Synonym: 2-naphthylacetic acid,2-naphthaleneacetic acid,2-naphthalen-2-yl acetic acid,betoxan,2-2-naphthyl acetic acid,beta-naphthylacetic acid,beta-naphthaleneacetic acid,beta-naphthaleneacetate,naphthalen-2-ylacetic acid,.beta.-naphthaleneacetic acid PubChem CID: 11393 ChEBI: CHEBI:37837 IUPAC Name: 2-naphthalen-2-ylacetic acid SMILES: OC(=O)CC1=CC=C2C=CC=CC2=C1
| PubChem CID | 11393 |
|---|---|
| CAS | 581-96-4 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:37837 |
| MDL Number | MFCD00004126 |
| SMILES | OC(=O)CC1=CC=C2C=CC=CC2=C1 |
| Synonym | 2-naphthylacetic acid,2-naphthaleneacetic acid,2-naphthalen-2-yl acetic acid,betoxan,2-2-naphthyl acetic acid,beta-naphthylacetic acid,beta-naphthaleneacetic acid,beta-naphthaleneacetate,naphthalen-2-ylacetic acid,.beta.-naphthaleneacetic acid |
| IUPAC Name | 2-naphthalen-2-ylacetic acid |
| InChI Key | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab.
CAS: 355-93-1 Molecular Formula: C9H8F8O2 Molecular Weight (g/mol): 300.15 MDL Number: MFCD00039278 InChI Key: ZNJXRXXJPIFFAO-UHFFFAOYSA-N Synonym: 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate PubChem CID: 67739 IUPAC Name: 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F
| PubChem CID | 67739 |
|---|---|
| CAS | 355-93-1 |
| Molecular Weight (g/mol) | 300.15 |
| MDL Number | MFCD00039278 |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Synonym | 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| InChI Key | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| Molecular Formula | C9H8F8O2 |
Ethyl 4-cyanophenylacetate, 98%, Thermo Scientific Chemicals
CAS: 1528-41-2 Molecular Formula: C11H11NO2 Molecular Weight (g/mol): 189.214 MDL Number: MFCD09953133 InChI Key: DFEWKWBIPMKGFG-UHFFFAOYSA-N Synonym: ethyl 2-4-cyanophenyl acetate,ethyl 4-cyanophenylacetate,ethyl 4-cyanophenyl acetate,4-cyano-phenyl acetic acid ethyl ester,ethyl p-cyanophenylacetate,acmc-1bve3,ethyl 4-cyanobenzeneacetate,ethyl4-cyanophenylacetate,4-cyanophenylacetic acid ethyl ester PubChem CID: 279718 IUPAC Name: ethyl 2-(4-cyanophenyl)acetate SMILES: CCOC(=O)CC1=CC=C(C=C1)C#N
| PubChem CID | 279718 |
|---|---|
| CAS | 1528-41-2 |
| Molecular Weight (g/mol) | 189.214 |
| MDL Number | MFCD09953133 |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)C#N |
| Synonym | ethyl 2-4-cyanophenyl acetate,ethyl 4-cyanophenylacetate,ethyl 4-cyanophenyl acetate,4-cyano-phenyl acetic acid ethyl ester,ethyl p-cyanophenylacetate,acmc-1bve3,ethyl 4-cyanobenzeneacetate,ethyl4-cyanophenylacetate,4-cyanophenylacetic acid ethyl ester |
| IUPAC Name | ethyl 2-(4-cyanophenyl)acetate |
| InChI Key | DFEWKWBIPMKGFG-UHFFFAOYSA-N |
| Molecular Formula | C11H11NO2 |
trans-Methyl crotonate, 96%
CAS: 623-43-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009287 InChI Key: MCVVUJPXSBQTRZ-ONEGZZNKSA-N Synonym: methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester PubChem CID: 638132 SMILES: COC(=O)\C=C\C
| PubChem CID | 638132 |
|---|---|
| CAS | 623-43-8 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00009287 |
| SMILES | COC(=O)\C=C\C |
| Synonym | methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester |
| InChI Key | MCVVUJPXSBQTRZ-ONEGZZNKSA-N |
| Molecular Formula | C5H8O2 |
MilliporeSigma™ EGTA, Molecular Biology Grade, Calbiochem™,
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
2(5H)-Furanone, 96%
CAS: 497-23-4 Molecular Formula: C4H4O2 Molecular Weight (g/mol): 84.07 MDL Number: MFCD00005376 InChI Key: VIHAEDVKXSOUAT-UHFFFAOYSA-N Synonym: 2 5h-furanone,furan-2 5h-one,butenolide,2-butenolide,gamma-crotonolactone,2-buten-4-olide,isocrotonolactone,2-oxo-2,5-dihydrofuran,crotonolactone,2-5h-furanone PubChem CID: 10341 ChEBI: CHEBI:38118 IUPAC Name: 2H-furan-5-one SMILES: O=C1OCC=C1
| PubChem CID | 10341 |
|---|---|
| CAS | 497-23-4 |
| Molecular Weight (g/mol) | 84.07 |
| ChEBI | CHEBI:38118 |
| MDL Number | MFCD00005376 |
| SMILES | O=C1OCC=C1 |
| Synonym | 2 5h-furanone,furan-2 5h-one,butenolide,2-butenolide,gamma-crotonolactone,2-buten-4-olide,isocrotonolactone,2-oxo-2,5-dihydrofuran,crotonolactone,2-5h-furanone |
| IUPAC Name | 2H-furan-5-one |
| InChI Key | VIHAEDVKXSOUAT-UHFFFAOYSA-N |
| Molecular Formula | C4H4O2 |
1-Naphthylacetic acid, 95%, may cont. up to 5% 2-isomer
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-naphthalen-1-ylacetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-naphthalen-1-ylacetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
trans-Indole-3-acrylic acid, 98+%
CAS: 29953-71-7 Molecular Formula: C11H9NO2 Molecular Weight (g/mol): 187.198 MDL Number: MFCD00005633 InChI Key: PLVPPLCLBIEYEA-AATRIKPKSA-N Synonym: 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van PubChem CID: 5375048 IUPAC Name: (E)-3-(1H-indol-3-yl)prop-2-enoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
| PubChem CID | 5375048 |
|---|---|
| CAS | 29953-71-7 |
| Molecular Weight (g/mol) | 187.198 |
| MDL Number | MFCD00005633 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Synonym | 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van |
| IUPAC Name | (E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| InChI Key | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Molecular Formula | C11H9NO2 |
4-tert-Butylbenzhydrazide, 98+%
CAS: 43100-38-5 Molecular Formula: C11H16N2O Molecular Weight (g/mol): 192.262 MDL Number: MFCD00014763 InChI Key: XYUFQWDLRLHUPB-UHFFFAOYSA-N Synonym: 4-tert-butylbenzhydrazide,4-tert-butyl benzohydrazide,benzoic acid, 4-1,1-dimethylethyl-, hydrazide,p-tert-butylbenzohydrazide,4-tert-butylbenzhyrazide,4-tert-butylbenzoic acid hydrazide,4-tert-butylbenzoic hydrazide,4-tert-butyl benzenecarbohydrazide,4-tert-butyl benzene-1-carbohydrazide,4-t-butylbenzhydrazide PubChem CID: 123513 IUPAC Name: 4-tert-butylbenzohydrazide SMILES: CC(C)(C)C1=CC=C(C=C1)C(=O)NN
| PubChem CID | 123513 |
|---|---|
| CAS | 43100-38-5 |
| Molecular Weight (g/mol) | 192.262 |
| MDL Number | MFCD00014763 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NN |
| Synonym | 4-tert-butylbenzhydrazide,4-tert-butyl benzohydrazide,benzoic acid, 4-1,1-dimethylethyl-, hydrazide,p-tert-butylbenzohydrazide,4-tert-butylbenzhyrazide,4-tert-butylbenzoic acid hydrazide,4-tert-butylbenzoic hydrazide,4-tert-butyl benzenecarbohydrazide,4-tert-butyl benzene-1-carbohydrazide,4-t-butylbenzhydrazide |
| IUPAC Name | 4-tert-butylbenzohydrazide |
| InChI Key | XYUFQWDLRLHUPB-UHFFFAOYSA-N |
| Molecular Formula | C11H16N2O |
5-Norbornene-2-carboxylic acid, 98%, mixture of isomers, Thermo Scientific Chemicals
CAS: 120-74-1 Molecular Formula: C8H10O2 Molecular Weight (g/mol): 138.16 InChI Key: FYGUSUBEMUKACF-UHFFFAOYSA-N Synonym: 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid PubChem CID: 78949 IUPAC Name: bicyclo[2.2.1]hept-2-ene-5-carboxylic acid SMILES: C1C2CC(C1C=C2)C(=O)O
| PubChem CID | 78949 |
|---|---|
| CAS | 120-74-1 |
| Molecular Weight (g/mol) | 138.16 |
| SMILES | C1C2CC(C1C=C2)C(=O)O |
| Synonym | 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-5-carboxylic acid |
| InChI Key | FYGUSUBEMUKACF-UHFFFAOYSA-N |
| Molecular Formula | C8H10O2 |
Di-tert-butyl hydrazodicarboxylate, 98+%
CAS: 16466-61-8 Molecular Formula: C10H20N2O4 Molecular Weight (g/mol): 232.28 MDL Number: MFCD00015000 InChI Key: TYSZETYVESRFNT-UHFFFAOYSA-N Synonym: di-tert-butyl hydrazodicarboxylate,di-tert-butyl hydrazine-1,2-dicarboxylate,di-tert-butyl hydrazodiformate,di-tert-butyl bicarbamate,n,n'-di-boc-hydrazine,n,n'-bis tert-butoxycarbonyl hydrazine,di-tert-butyl-1,2-hydrazodicarboxylate,1,2-hydrazinedicarboxylic acid, bis 1,1-dimethylethyl ester,tert-butyl n-2-methylpropan-2-yl oxycarbonylamino carbamate,n'-tert-butoxy carbonyl tert-butoxy carbohydrazide PubChem CID: 85431 IUPAC Name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate SMILES: CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C
| PubChem CID | 85431 |
|---|---|
| CAS | 16466-61-8 |
| Molecular Weight (g/mol) | 232.28 |
| MDL Number | MFCD00015000 |
| SMILES | CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C |
| Synonym | di-tert-butyl hydrazodicarboxylate,di-tert-butyl hydrazine-1,2-dicarboxylate,di-tert-butyl hydrazodiformate,di-tert-butyl bicarbamate,n,n'-di-boc-hydrazine,n,n'-bis tert-butoxycarbonyl hydrazine,di-tert-butyl-1,2-hydrazodicarboxylate,1,2-hydrazinedicarboxylic acid, bis 1,1-dimethylethyl ester,tert-butyl n-2-methylpropan-2-yl oxycarbonylamino carbamate,n'-tert-butoxy carbonyl tert-butoxy carbohydrazide |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChI Key | TYSZETYVESRFNT-UHFFFAOYSA-N |
| Molecular Formula | C10H20N2O4 |